C8H12O8 — CID 87902717
acetyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 87902717) has the molecular formula C8H12O8 and a molecular weight of 236.18 g/mol. Its IUPAC name is acetyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | acetyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 87902717 |
| Molecular Formula | C8H12O8 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | acetyl (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | CC(=O)OC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C8H12O8/c1-3(10)16-8(15)7(14)6(13)5(12)4(11)2-9/h2,4-7,11-14H,1H3/t4-,5+,6-,7-/m0/s1 |
| InChIKey | LFVDETIUTGXNKY-VZFHVOOUSA-N |
| XLogP | -3.28 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|