C6H16O19S3 — CID 174175458
sulfuric acid;2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 174175458) has the molecular formula C6H16O19S3 and a molecular weight of 488.38 g/mol. Its IUPAC name is sulfuric acid;2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | sulfuric acid;2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 174175458 |
| Molecular Formula | C6H16O19S3 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.94 |
| IUPAC Name | sulfuric acid;2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=CC(O)C(O)C(O)C(O)C(=O)O.O=S(=O)(O)O.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C6H10O7.3H2O4S/c7-1-2(8)3(9)4(10)5(11)6(12)13;3*1-5(2,3)4/h1-5,8-11H,(H,12,13);3*(H2,1,2,3,4) |
| InChIKey | GNPZFQXLLVFKHM-UHFFFAOYSA-N |
| XLogP | -5.24 |
| TPSA | 359.09 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|