C6H11Na3O14P2 — CID 174826571
trisodium;[hydroxy(oxido)phosphoryl] phosphate;2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 174826571) has the molecular formula C6H11Na3O14P2 and a molecular weight of 438.06 g/mol. Its IUPAC name is trisodium;[hydroxy(oxido)phosphoryl] phosphate;2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | trisodium;[hydroxy(oxido)phosphoryl] phosphate;2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 174826571 |
| Molecular Formula | C6H11Na3O14P2 |
| Molecular Weight | 438.06 g/mol |
| Exact Mass | 437.93 |
| IUPAC Name | trisodium;[hydroxy(oxido)phosphoryl] phosphate;2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=CC(O)C(O)C(O)C(O)C(=O)O.O=P([O-])([O-])OP(=O)([O-])O.[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H10O7.3Na.H4O7P2/c7-1-2(8)3(9)4(10)5(11)6(12)13;;;;1-8(2,3)7-9(4,5)6/h1-5,8-11H,(H,12,13);;;;(H2,1,2,3)(H2,4,5,6)/q;3*+1;/p-3 |
| InChIKey | KVJBGAAVYYYYPF-UHFFFAOYSA-K |
| XLogP | -14.98 |
| TPSA | 268.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.06 |
| LogP ≤ 5 | -14.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|