C6H12Na4O13P2 — CID 19360003
tetrasodium;2,3,4,5,6-pentahydroxyhexanal;phosphonato phosphate (PubChem CID 19360003) has the molecular formula C6H12Na4O13P2 and a molecular weight of 446.06 g/mol. Its IUPAC name is tetrasodium;2,3,4,5,6-pentahydroxyhexanal;phosphonato phosphate.
| Compound Name | tetrasodium;2,3,4,5,6-pentahydroxyhexanal;phosphonato phosphate |
|---|---|
| PubChem CID | 19360003 |
| Molecular Formula | C6H12Na4O13P2 |
| Molecular Weight | 446.06 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | tetrasodium;2,3,4,5,6-pentahydroxyhexanal;phosphonato phosphate |
| SMILES | O=CC(O)C(O)C(O)C(O)CO.O=P([O-])([O-])OP(=O)([O-])[O-].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H12O6.4Na.H4O7P2/c7-1-3(9)5(11)6(12)4(10)2-8;;;;;1-8(2,3)7-9(4,5)6/h1,3-6,8-12H,2H2;;;;;(H2,1,2,3)(H2,4,5,6)/q;4*+1;/p-4 |
| InChIKey | NNVXLQYSZIVDTF-UHFFFAOYSA-J |
| XLogP | -18.70 |
| TPSA | 253.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.06 |
| LogP ≤ 5 | -18.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|