C9H11IO8 — CID 175833763
(2S,3R,4S,5S)-2,3,5-trihydroxy-4-(2-iodoprop-2-enoyloxy)-6-oxohexanoic acid (PubChem CID 175833763) has the molecular formula C9H11IO8 and a molecular weight of 374.08 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2,3,5-trihydroxy-4-(2-iodoprop-2-enoyloxy)-6-oxohexanoic acid.
| Compound Name | (2S,3R,4S,5S)-2,3,5-trihydroxy-4-(2-iodoprop-2-enoyloxy)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 175833763 |
| Molecular Formula | C9H11IO8 |
| Molecular Weight | 374.08 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | (2S,3R,4S,5S)-2,3,5-trihydroxy-4-(2-iodoprop-2-enoyloxy)-6-oxohexanoic acid |
| SMILES | C=C(I)C(=O)O[C@@H]([C@H](O)[C@H](O)C(=O)O)[C@H](O)C=O |
| InChI | InChI=1S/C9H11IO8/c1-3(10)9(17)18-7(4(12)2-11)5(13)6(14)8(15)16/h2,4-7,12-14H,1H2,(H,15,16)/t4-,5-,6+,7-/m1/s1 |
| InChIKey | ZNOFKVMZYLMAFE-MVIOUDGNSA-N |
| XLogP | -1.79 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.08 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|