C7H12O7 — CID 87205204
(2S,3R,4S,5R)-2,3,4-trihydroxy-5-methoxy-6-oxohexanoic acid (PubChem CID 87205204) has the molecular formula C7H12O7 and a molecular weight of 208.17 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4-trihydroxy-5-methoxy-6-oxohexanoic acid.
| Compound Name | (2S,3R,4S,5R)-2,3,4-trihydroxy-5-methoxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87205204 |
| Molecular Formula | C7H12O7 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4-trihydroxy-5-methoxy-6-oxohexanoic acid |
| SMILES | CO[C@@H](C=O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C7H12O7/c1-14-3(2-8)4(9)5(10)6(11)7(12)13/h2-6,9-11H,1H3,(H,12,13)/t3-,4+,5+,6-/m0/s1 |
| InChIKey | HCQISUFWFYMWKK-KCDKBNATSA-N |
| XLogP | -2.63 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|