C9H16O7 — CID 162952592
(2S,3R,4R,5R)-2-hydroxy-3,4,5-trimethoxy-6-oxohexanoic acid (PubChem CID 162952592) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-hydroxy-3,4,5-trimethoxy-6-oxohexanoic acid.
| Compound Name | (2S,3R,4R,5R)-2-hydroxy-3,4,5-trimethoxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 162952592 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2S,3R,4R,5R)-2-hydroxy-3,4,5-trimethoxy-6-oxohexanoic acid |
| SMILES | CO[C@H]([C@H](OC)[C@H](O)C(=O)O)[C@H](C=O)OC |
| InChI | InChI=1S/C9H16O7/c1-14-5(4-10)7(15-2)8(16-3)6(11)9(12)13/h4-8,11H,1-3H3,(H,12,13)/t5-,6-,7-,8+/m0/s1 |
| InChIKey | DEJMWXKSKDWWTC-DKXJUACHSA-N |
| XLogP | -1.32 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|