C9H16O4 — CID 14374465
(2S,3R,4S)-2,3,4-trimethoxyhex-5-enal (PubChem CID 14374465) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (2S,3R,4S)-2,3,4-trimethoxyhex-5-enal.
| Compound Name | (2S,3R,4S)-2,3,4-trimethoxyhex-5-enal |
|---|---|
| PubChem CID | 14374465 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2S,3R,4S)-2,3,4-trimethoxyhex-5-enal |
| SMILES | C=C[C@H](OC)[C@@H](OC)[C@@H](C=O)OC |
| InChI | InChI=1S/C9H16O4/c1-5-7(11-2)9(13-4)8(6-10)12-3/h5-9H,1H2,2-4H3/t7-,8+,9+/m0/s1 |
| InChIKey | DTGBDOVKSKTGFU-DJLDLDEBSA-N |
| XLogP | 0.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|