C12H22O3 — CID 89393707
(E,2R,3R,4S,5S)-3,5-dimethoxy-2,4-dimethyloct-6-enal (PubChem CID 89393707) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (E,2R,3R,4S,5S)-3,5-dimethoxy-2,4-dimethyloct-6-enal.
| Compound Name | (E,2R,3R,4S,5S)-3,5-dimethoxy-2,4-dimethyloct-6-enal |
|---|---|
| PubChem CID | 89393707 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E,2R,3R,4S,5S)-3,5-dimethoxy-2,4-dimethyloct-6-enal |
| SMILES | C/C=C/[C@H](OC)[C@H](C)[C@@H](OC)C(C)C=O |
| InChI | InChI=1S/C12H22O3/c1-6-7-11(14-4)10(3)12(15-5)9(2)8-13/h6-12H,1-5H3/b7-6+/t9?,10-,11-,12-/m0/s1 |
| InChIKey | GZVHYJAKTOTXQF-KJVQSVJMSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|