C9H18O6 — CID 88673792
(2R,3S,4R,5R)-4,5-dihydroxy-3-methoxy-2,6-bis(trideuteriomethoxy)hexanal (PubChem CID 88673792) has the molecular formula C9H18O6 and a molecular weight of 228.27 g/mol. Its IUPAC name is (2R,3S,4R,5R)-4,5-dihydroxy-3-methoxy-2,6-bis(trideuteriomethoxy)hexanal.
| Compound Name | (2R,3S,4R,5R)-4,5-dihydroxy-3-methoxy-2,6-bis(trideuteriomethoxy)hexanal |
|---|---|
| PubChem CID | 88673792 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2R,3S,4R,5R)-4,5-dihydroxy-3-methoxy-2,6-bis(trideuteriomethoxy)hexanal |
| SMILES | [2H]C([2H])([2H])OC[C@@H](O)[C@@H](O)[C@H](OC)[C@H](C=O)OC([2H])([2H])[2H] |
| InChI | InChI=1S/C9H18O6/c1-13-5-6(11)8(12)9(15-3)7(4-10)14-2/h4,6-9,11-12H,5H2,1-3H3/t6-,7+,8-,9-/m1/s1/i1D3,2D3 |
| InChIKey | PWBXSZOZBWBLEW-KJXJZWGUSA-N |
| XLogP | -1.42 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|