C7H14O2 — CID 124636649
(2R,3S)-2-methoxy-3-methylpentanal (PubChem CID 124636649) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (2R,3S)-2-methoxy-3-methylpentanal.
| Compound Name | (2R,3S)-2-methoxy-3-methylpentanal |
|---|---|
| PubChem CID | 124636649 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (2R,3S)-2-methoxy-3-methylpentanal |
| SMILES | CC[C@H](C)[C@H](C=O)OC |
| InChI | InChI=1S/C7H14O2/c1-4-6(2)7(5-8)9-3/h5-7H,4H2,1-3H3/t6-,7-/m0/s1 |
| InChIKey | RGNLXKQOCWDZPK-BQBZGAKWSA-N |
| XLogP | 1.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|