C10H24N2O8 — CID 174560140
2,3-dihydroxybutanedioic acid;bis(1-methoxyethanamine) (PubChem CID 174560140) has the molecular formula C10H24N2O8 and a molecular weight of 300.31 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;bis(1-methoxyethanamine).
| Compound Name | 2,3-dihydroxybutanedioic acid;bis(1-methoxyethanamine) |
|---|---|
| PubChem CID | 174560140 |
| Molecular Formula | C10H24N2O8 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;bis(1-methoxyethanamine) |
| SMILES | COC(C)N.COC(C)N.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C4H6O6.2C3H9NO/c5-1(3(7)8)2(6)4(9)10;2*1-3(4)5-2/h1-2,5-6H,(H,7,8)(H,9,10);2*3H,4H2,1-2H3 |
| InChIKey | DOMFLBBNWYLVFT-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|