About 1-methoxyethanamine;2-oxopropanoic acid
1-methoxyethanamine;2-oxopropanoic acid (PubChem CID 174574648) has the molecular formula C6H13NO4
and a molecular weight of 163.17 g/mol. Its IUPAC name is 1-methoxyethanamine;2-oxopropanoic acid.
Molecular Properties
| Compound Name | 1-methoxyethanamine;2-oxopropanoic acid |
| PubChem CID | 174574648 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1-methoxyethanamine;2-oxopropanoic acid |
| SMILES | CC(=O)C(=O)O.COC(C)N |
| InChI | InChI=1S/C3H9NO.C3H4O3/c1-3(4)5-2;1-2(4)3(5)6/h3H,4H2,1-2H3;1H3,(H,5,6) |
| InChIKey | NWOURPMQTDTGKH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethanamine;2-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethanamine;2-oxopropanoic acid?
The IUPAC name of 1-methoxyethanamine;2-oxopropanoic acid (CID 174574648) is 1-methoxyethanamine;2-oxopropanoic acid.
What is the SMILES notation for 1-methoxyethanamine;2-oxopropanoic acid?
The canonical SMILES for 1-methoxyethanamine;2-oxopropanoic acid is CC(=O)C(=O)O.COC(C)N.
What is the InChIKey of 1-methoxyethanamine;2-oxopropanoic acid?
The InChIKey is NWOURPMQTDTGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.C3H4O3/c1-3(4)5-2;1-2(4)3(5)6/h3H,4H2,1-2H3;1H3,(H,5,6).
What are the key properties of 1-methoxyethanamine;2-oxopropanoic acid?
1-methoxyethanamine;2-oxopropanoic acid has a molecular weight of 163.17 g/mol, XLogP of -0.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethanamine;2-oxopropanoic acid is sourced from PubChem (CID 174574648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).