About strontium 2-oxopropanoic acid
strontium 2-oxopropanoic acid (PubChem CID 10154276) has the molecular formula C3H4O3Sr+2
and a molecular weight of 175.68 g/mol. Its IUPAC name is strontium 2-oxopropanoic acid.
Molecular Properties
| Compound Name | strontium 2-oxopropanoic acid |
| PubChem CID | 10154276 |
| Molecular Formula | C3H4O3Sr+2 |
| Molecular Weight | 175.68 g/mol |
| Exact Mass | 175.92 |
| IUPAC Name | strontium 2-oxopropanoic acid |
| SMILES | CC(=O)C(=O)O.[Sr+2] |
| InChI | InChI=1S/C3H4O3.Sr/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+2 |
| InChIKey | FVBKDMIYJKVPJT-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.68 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze strontium 2-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of strontium 2-oxopropanoic acid?
The IUPAC name of strontium 2-oxopropanoic acid (CID 10154276) is strontium 2-oxopropanoic acid.
What is the SMILES notation for strontium 2-oxopropanoic acid?
The canonical SMILES for strontium 2-oxopropanoic acid is CC(=O)C(=O)O.[Sr+2].
What is the InChIKey of strontium 2-oxopropanoic acid?
The InChIKey is FVBKDMIYJKVPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3.Sr/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+2.
What are the key properties of strontium 2-oxopropanoic acid?
strontium 2-oxopropanoic acid has a molecular weight of 175.68 g/mol, XLogP of -0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for strontium 2-oxopropanoic acid is sourced from PubChem (CID 10154276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).