About sodium;2-oxopropanoic acid;chloride
sodium;2-oxopropanoic acid;chloride (PubChem CID 173324944) has the molecular formula C3H4ClNaO3
and a molecular weight of 146.50 g/mol. Its IUPAC name is sodium;2-oxopropanoic acid;chloride.
Molecular Properties
| Compound Name | sodium;2-oxopropanoic acid;chloride |
| PubChem CID | 173324944 |
| Molecular Formula | C3H4ClNaO3 |
| Molecular Weight | 146.50 g/mol |
| Exact Mass | 145.97 |
| IUPAC Name | sodium;2-oxopropanoic acid;chloride |
| SMILES | CC(=O)C(=O)O.[Cl-].[Na+] |
| InChI | InChI=1S/C3H4O3.ClH.Na/c1-2(4)3(5)6;;/h1H3,(H,5,6);1H;/q;;+1/p-1 |
| InChIKey | RPILJHBNCILCAP-UHFFFAOYSA-M |
| XLogP | -6.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.50 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-oxopropanoic acid;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-oxopropanoic acid;chloride?
The IUPAC name of sodium;2-oxopropanoic acid;chloride (CID 173324944) is sodium;2-oxopropanoic acid;chloride.
What is the SMILES notation for sodium;2-oxopropanoic acid;chloride?
The canonical SMILES for sodium;2-oxopropanoic acid;chloride is CC(=O)C(=O)O.[Cl-].[Na+].
What is the InChIKey of sodium;2-oxopropanoic acid;chloride?
The InChIKey is RPILJHBNCILCAP-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H4O3.ClH.Na/c1-2(4)3(5)6;;/h1H3,(H,5,6);1H;/q;;+1/p-1.
What are the key properties of sodium;2-oxopropanoic acid;chloride?
sodium;2-oxopropanoic acid;chloride has a molecular weight of 146.50 g/mol, XLogP of -6.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-oxopropanoic acid;chloride is sourced from PubChem (CID 173324944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).