C7H10O8 — CID 88640812
2,3-dihydroxy-4-(2-hydroxypropanoyloxy)-4-oxobutanoic acid (PubChem CID 88640812) has the molecular formula C7H10O8 and a molecular weight of 222.15 g/mol. Its IUPAC name is 2,3-dihydroxy-4-(2-hydroxypropanoyloxy)-4-oxobutanoic acid.
| Compound Name | 2,3-dihydroxy-4-(2-hydroxypropanoyloxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88640812 |
| Molecular Formula | C7H10O8 |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 2,3-dihydroxy-4-(2-hydroxypropanoyloxy)-4-oxobutanoic acid |
| SMILES | CC(O)C(=O)OC(=O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C7H10O8/c1-2(8)6(13)15-7(14)4(10)3(9)5(11)12/h2-4,8-10H,1H3,(H,11,12) |
| InChIKey | KSXSAGWFZNPFAS-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|