C8H13CrNO6 — CID 174924708
(2S)-2-amino-5-(2-hydroxypropanoyloxy)-5-oxopentanoic acid;chromium (PubChem CID 174924708) has the molecular formula C8H13CrNO6 and a molecular weight of 271.19 g/mol. Its IUPAC name is (2S)-2-amino-5-(2-hydroxypropanoyloxy)-5-oxopentanoic acid;chromium.
| Compound Name | (2S)-2-amino-5-(2-hydroxypropanoyloxy)-5-oxopentanoic acid;chromium |
|---|---|
| PubChem CID | 174924708 |
| Molecular Formula | C8H13CrNO6 |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | (2S)-2-amino-5-(2-hydroxypropanoyloxy)-5-oxopentanoic acid;chromium |
| SMILES | CC(O)C(=O)OC(=O)CC[C@H](N)C(=O)O.[Cr] |
| InChI | InChI=1S/C8H13NO6.Cr/c1-4(10)8(14)15-6(11)3-2-5(9)7(12)13;/h4-5,10H,2-3,9H2,1H3,(H,12,13);/t4?,5-;/m0./s1 |
| InChIKey | PEJUKAGEFPIZDW-YKXIHYLHSA-N |
| XLogP | -1.37 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|