About 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate
2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate (PubChem CID 154267844) has the molecular formula C10H14O9
and a molecular weight of 278.21 g/mol. Its IUPAC name is 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate.
Molecular Properties
| Compound Name | 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate |
| PubChem CID | 154267844 |
| Molecular Formula | C10H14O9 |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate |
| SMILES | CC(O)C(=O)OOC(=O)CCC(=O)OC(=O)C(C)O |
| InChI | InChI=1S/C10H14O9/c1-5(11)9(15)17-7(13)3-4-8(14)18-19-10(16)6(2)12/h5-6,11-12H,3-4H2,1-2H3 |
| InChIKey | IRMBUGYHOUHGTK-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate?
The IUPAC name of 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate (CID 154267844) is 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate.
What is the SMILES notation for 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate?
The canonical SMILES for 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate is CC(O)C(=O)OOC(=O)CCC(=O)OC(=O)C(C)O.
What is the InChIKey of 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate?
The InChIKey is IRMBUGYHOUHGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O9/c1-5(11)9(15)17-7(13)3-4-8(14)18-19-10(16)6(2)12/h5-6,11-12H,3-4H2,1-2H3.
What are the key properties of 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate?
2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate has a molecular weight of 278.21 g/mol, XLogP of -1.40, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoyl 4-(2-hydroxypropanoylperoxy)-4-oxobutanoate is sourced from PubChem (CID 154267844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).