C15H20O16 — CID 141409708
tris(2-hydroxypropanoyl) 2-hydroxypropane-1,2,3-tricarboperoxoate (PubChem CID 141409708) has the molecular formula C15H20O16 and a molecular weight of 456.31 g/mol. Its IUPAC name is tris(2-hydroxypropanoyl) 2-hydroxypropane-1,2,3-tricarboperoxoate.
| Compound Name | tris(2-hydroxypropanoyl) 2-hydroxypropane-1,2,3-tricarboperoxoate |
|---|---|
| PubChem CID | 141409708 |
| Molecular Formula | C15H20O16 |
| Molecular Weight | 456.31 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | tris(2-hydroxypropanoyl) 2-hydroxypropane-1,2,3-tricarboperoxoate |
| SMILES | CC(O)C(=O)OOC(=O)CC(O)(CC(=O)OOC(=O)C(C)O)C(=O)OOC(=O)C(C)O |
| InChI | InChI=1S/C15H20O16/c1-6(16)11(21)28-26-9(19)4-15(25,14(24)31-30-13(23)8(3)18)5-10(20)27-29-12(22)7(2)17/h6-8,16-18,25H,4-5H2,1-3H3 |
| InChIKey | UKOWKKRMGPBANT-UHFFFAOYSA-N |
| XLogP | -3.36 |
| TPSA | 238.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.31 |
| LogP ≤ 5 | -3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|