C14H18O16 — CID 59294795
2-[2-[2-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanoyl]peroxyethylperoxy]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 59294795) has the molecular formula C14H18O16 and a molecular weight of 442.28 g/mol. Its IUPAC name is 2-[2-[2-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanoyl]peroxyethylperoxy]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[2-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanoyl]peroxyethylperoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 59294795 |
| Molecular Formula | C14H18O16 |
| Molecular Weight | 442.28 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[2-[2-[3-carboxy-2-(carboxymethyl)-2-hydroxypropanoyl]peroxyethylperoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OOCCOOC(=O)C(O)(CC(=O)O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H18O16/c15-7(16)3-13(25,11(22)23)6-10(21)29-27-1-2-28-30-12(24)14(26,4-8(17)18)5-9(19)20/h25-26H,1-6H2,(H,15,16)(H,17,18)(H,19,20)(H,22,23) |
| InChIKey | HOKATYJACIEULB-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 260.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.28 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|