C11H18O8 — CID 150843708
2-hydroxy-2-(2-oxo-2-pentylperoxyethyl)butanedioic acid (PubChem CID 150843708) has the molecular formula C11H18O8 and a molecular weight of 278.26 g/mol. Its IUPAC name is 2-hydroxy-2-(2-oxo-2-pentylperoxyethyl)butanedioic acid.
| Compound Name | 2-hydroxy-2-(2-oxo-2-pentylperoxyethyl)butanedioic acid |
|---|---|
| PubChem CID | 150843708 |
| Molecular Formula | C11H18O8 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-hydroxy-2-(2-oxo-2-pentylperoxyethyl)butanedioic acid |
| SMILES | CCCCCOOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18O8/c1-2-3-4-5-18-19-9(14)7-11(17,10(15)16)6-8(12)13/h17H,2-7H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | KONUTAVPPRODEM-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|