C10H18O5 — CID 91039088
2-hydroxypropanoyl 2-hydroxy-2,3,3-trimethylbutanoate (PubChem CID 91039088) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-hydroxypropanoyl 2-hydroxy-2,3,3-trimethylbutanoate.
| Compound Name | 2-hydroxypropanoyl 2-hydroxy-2,3,3-trimethylbutanoate |
|---|---|
| PubChem CID | 91039088 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-hydroxypropanoyl 2-hydroxy-2,3,3-trimethylbutanoate |
| SMILES | CC(O)C(=O)OC(=O)C(C)(O)C(C)(C)C |
| InChI | InChI=1S/C10H18O5/c1-6(11)7(12)15-8(13)10(5,14)9(2,3)4/h6,11,14H,1-5H3 |
| InChIKey | BBFQWMOHUYUQNG-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|