About (2-aminoacetyl) 2-hydroxypropanoate;copper
(2-aminoacetyl) 2-hydroxypropanoate;copper (PubChem CID 87635817) has the molecular formula C5H9CuNO4
and a molecular weight of 210.68 g/mol. Its IUPAC name is (2-aminoacetyl) 2-hydroxypropanoate;copper.
Molecular Properties
| Compound Name | (2-aminoacetyl) 2-hydroxypropanoate;copper |
| PubChem CID | 87635817 |
| Molecular Formula | C5H9CuNO4 |
| Molecular Weight | 210.68 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | (2-aminoacetyl) 2-hydroxypropanoate;copper |
| SMILES | CC(O)C(=O)OC(=O)CN.[Cu] |
| InChI | InChI=1S/C5H9NO4.Cu/c1-3(7)5(9)10-4(8)2-6;/h3,7H,2,6H2,1H3; |
| InChIKey | FZMJKLDNLISUPQ-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.68 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoacetyl) 2-hydroxypropanoate;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoacetyl) 2-hydroxypropanoate;copper?
The IUPAC name of (2-aminoacetyl) 2-hydroxypropanoate;copper (CID 87635817) is (2-aminoacetyl) 2-hydroxypropanoate;copper.
What is the SMILES notation for (2-aminoacetyl) 2-hydroxypropanoate;copper?
The canonical SMILES for (2-aminoacetyl) 2-hydroxypropanoate;copper is CC(O)C(=O)OC(=O)CN.[Cu].
What is the InChIKey of (2-aminoacetyl) 2-hydroxypropanoate;copper?
The InChIKey is FZMJKLDNLISUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO4.Cu/c1-3(7)5(9)10-4(8)2-6;/h3,7H,2,6H2,1H3;.
What are the key properties of (2-aminoacetyl) 2-hydroxypropanoate;copper?
(2-aminoacetyl) 2-hydroxypropanoate;copper has a molecular weight of 210.68 g/mol, XLogP of -1.61, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoacetyl) 2-hydroxypropanoate;copper is sourced from PubChem (CID 87635817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).