About (2-aminoacetyl) 2-propylpentanoate
(2-aminoacetyl) 2-propylpentanoate (PubChem CID 87611330) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is (2-aminoacetyl) 2-propylpentanoate.
Molecular Properties
| Compound Name | (2-aminoacetyl) 2-propylpentanoate |
| PubChem CID | 87611330 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (2-aminoacetyl) 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OC(=O)CN |
| InChI | InChI=1S/C10H19NO3/c1-3-5-8(6-4-2)10(13)14-9(12)7-11/h8H,3-7,11H2,1-2H3 |
| InChIKey | ZFKSOAXUMNQFGY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-aminoacetyl) 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminoacetyl) 2-propylpentanoate?
The IUPAC name of (2-aminoacetyl) 2-propylpentanoate (CID 87611330) is (2-aminoacetyl) 2-propylpentanoate.
What is the SMILES notation for (2-aminoacetyl) 2-propylpentanoate?
The canonical SMILES for (2-aminoacetyl) 2-propylpentanoate is CCCC(CCC)C(=O)OC(=O)CN.
What is the InChIKey of (2-aminoacetyl) 2-propylpentanoate?
The InChIKey is ZFKSOAXUMNQFGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-3-5-8(6-4-2)10(13)14-9(12)7-11/h8H,3-7,11H2,1-2H3.
What are the key properties of (2-aminoacetyl) 2-propylpentanoate?
(2-aminoacetyl) 2-propylpentanoate has a molecular weight of 201.27 g/mol, XLogP of 1.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminoacetyl) 2-propylpentanoate is sourced from PubChem (CID 87611330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).