About (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride
(5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride (PubChem CID 25155288) has the molecular formula C14H26ClNO5
and a molecular weight of 323.82 g/mol. Its IUPAC name is (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride.
Molecular Properties
| Compound Name | (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride |
| PubChem CID | 25155288 |
| Molecular Formula | C14H26ClNO5 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride |
| SMILES | CCCC(CCC)C(=O)OCOC(=O)CCC(=O)CN.Cl |
| InChI | InChI=1S/C14H25NO5.ClH/c1-3-5-11(6-4-2)14(18)20-10-19-13(17)8-7-12(16)9-15;/h11H,3-10,15H2,1-2H3;1H |
| InChIKey | OJUGTWYCTUIIIG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride?
The IUPAC name of (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride (CID 25155288) is (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride.
What is the SMILES notation for (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride?
The canonical SMILES for (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride is CCCC(CCC)C(=O)OCOC(=O)CCC(=O)CN.Cl.
What is the InChIKey of (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride?
The InChIKey is OJUGTWYCTUIIIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO5.ClH/c1-3-5-11(6-4-2)14(18)20-10-19-13(17)8-7-12(16)9-15;/h11H,3-10,15H2,1-2H3;1H.
What are the key properties of (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride?
(5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride has a molecular weight of 323.82 g/mol, XLogP of 1.98, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-4-oxopentanoyl)oxymethyl 2-propylpentanoate;hydrochloride is sourced from PubChem (CID 25155288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).