About 2-propylpentanoyl 2-propylpentanoate
2-propylpentanoyl 2-propylpentanoate (PubChem CID 10923624) has the molecular formula C16H30O3
and a molecular weight of 270.41 g/mol. Its IUPAC name is 2-propylpentanoyl 2-propylpentanoate.
Molecular Properties
| Compound Name | 2-propylpentanoyl 2-propylpentanoate |
| PubChem CID | 10923624 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 2-propylpentanoyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OC(=O)C(CCC)CCC |
| InChI | InChI=1S/C16H30O3/c1-5-9-13(10-6-2)15(17)19-16(18)14(11-7-3)12-8-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | GYIUDLLQLVWKPP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-propylpentanoyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpentanoyl 2-propylpentanoate?
The IUPAC name of 2-propylpentanoyl 2-propylpentanoate (CID 10923624) is 2-propylpentanoyl 2-propylpentanoate.
What is the SMILES notation for 2-propylpentanoyl 2-propylpentanoate?
The canonical SMILES for 2-propylpentanoyl 2-propylpentanoate is CCCC(CCC)C(=O)OC(=O)C(CCC)CCC.
What is the InChIKey of 2-propylpentanoyl 2-propylpentanoate?
The InChIKey is GYIUDLLQLVWKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O3/c1-5-9-13(10-6-2)15(17)19-16(18)14(11-7-3)12-8-4/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-propylpentanoyl 2-propylpentanoate?
2-propylpentanoyl 2-propylpentanoate has a molecular weight of 270.41 g/mol, XLogP of 4.49, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpentanoyl 2-propylpentanoate is sourced from PubChem (CID 10923624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).