About 2-cyanoethylcarbamoyl 2-propylpentanoate
2-cyanoethylcarbamoyl 2-propylpentanoate (PubChem CID 91552443) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-cyanoethylcarbamoyl 2-propylpentanoate.
Molecular Properties
| Compound Name | 2-cyanoethylcarbamoyl 2-propylpentanoate |
| PubChem CID | 91552443 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-cyanoethylcarbamoyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OC(=O)NCCC#N |
| InChI | InChI=1S/C12H20N2O3/c1-3-6-10(7-4-2)11(15)17-12(16)14-9-5-8-13/h10H,3-7,9H2,1-2H3,(H,14,16) |
| InChIKey | DIYKFGNSEYOJPZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethylcarbamoyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethylcarbamoyl 2-propylpentanoate?
The IUPAC name of 2-cyanoethylcarbamoyl 2-propylpentanoate (CID 91552443) is 2-cyanoethylcarbamoyl 2-propylpentanoate.
What is the SMILES notation for 2-cyanoethylcarbamoyl 2-propylpentanoate?
The canonical SMILES for 2-cyanoethylcarbamoyl 2-propylpentanoate is CCCC(CCC)C(=O)OC(=O)NCCC#N.
What is the InChIKey of 2-cyanoethylcarbamoyl 2-propylpentanoate?
The InChIKey is DIYKFGNSEYOJPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3/c1-3-6-10(7-4-2)11(15)17-12(16)14-9-5-8-13/h10H,3-7,9H2,1-2H3,(H,14,16).
What are the key properties of 2-cyanoethylcarbamoyl 2-propylpentanoate?
2-cyanoethylcarbamoyl 2-propylpentanoate has a molecular weight of 240.30 g/mol, XLogP of 2.37, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethylcarbamoyl 2-propylpentanoate is sourced from PubChem (CID 91552443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).