About acetic acid;(2-aminoacetyl) 2-aminoacetate
acetic acid;(2-aminoacetyl) 2-aminoacetate (PubChem CID 174797660) has the molecular formula C6H12N2O5
and a molecular weight of 192.17 g/mol. Its IUPAC name is acetic acid;(2-aminoacetyl) 2-aminoacetate.
Molecular Properties
| Compound Name | acetic acid;(2-aminoacetyl) 2-aminoacetate |
| PubChem CID | 174797660 |
| Molecular Formula | C6H12N2O5 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | acetic acid;(2-aminoacetyl) 2-aminoacetate |
| SMILES | CC(=O)O.NCC(=O)OC(=O)CN |
| InChI | InChI=1S/C4H8N2O3.C2H4O2/c5-1-3(7)9-4(8)2-6;1-2(3)4/h1-2,5-6H2;1H3,(H,3,4) |
| InChIKey | KBSPASZJEALCGX-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(2-aminoacetyl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(2-aminoacetyl) 2-aminoacetate?
The IUPAC name of acetic acid;(2-aminoacetyl) 2-aminoacetate (CID 174797660) is acetic acid;(2-aminoacetyl) 2-aminoacetate.
What is the SMILES notation for acetic acid;(2-aminoacetyl) 2-aminoacetate?
The canonical SMILES for acetic acid;(2-aminoacetyl) 2-aminoacetate is CC(=O)O.NCC(=O)OC(=O)CN.
What is the InChIKey of acetic acid;(2-aminoacetyl) 2-aminoacetate?
The InChIKey is KBSPASZJEALCGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O3.C2H4O2/c5-1-3(7)9-4(8)2-6;1-2(3)4/h1-2,5-6H2;1H3,(H,3,4).
What are the key properties of acetic acid;(2-aminoacetyl) 2-aminoacetate?
acetic acid;(2-aminoacetyl) 2-aminoacetate has a molecular weight of 192.17 g/mol, XLogP of -1.94, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2-aminoacetyl) 2-aminoacetate is sourced from PubChem (CID 174797660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).