About acetic acid;ethyl 2-aminoacetate;hydrochloride
acetic acid;ethyl 2-aminoacetate;hydrochloride (PubChem CID 172784195) has the molecular formula C6H14ClNO4
and a molecular weight of 199.63 g/mol. Its IUPAC name is acetic acid;ethyl 2-aminoacetate;hydrochloride.
Molecular Properties
| Compound Name | acetic acid;ethyl 2-aminoacetate;hydrochloride |
| PubChem CID | 172784195 |
| Molecular Formula | C6H14ClNO4 |
| Molecular Weight | 199.63 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | acetic acid;ethyl 2-aminoacetate;hydrochloride |
| SMILES | CC(=O)O.CCOC(=O)CN.Cl |
| InChI | InChI=1S/C4H9NO2.C2H4O2.ClH/c1-2-7-4(6)3-5;1-2(3)4;/h2-3,5H2,1H3;1H3,(H,3,4);1H |
| InChIKey | OQVBTOHPGYKRAR-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.63 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;ethyl 2-aminoacetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;ethyl 2-aminoacetate;hydrochloride?
The IUPAC name of acetic acid;ethyl 2-aminoacetate;hydrochloride (CID 172784195) is acetic acid;ethyl 2-aminoacetate;hydrochloride.
What is the SMILES notation for acetic acid;ethyl 2-aminoacetate;hydrochloride?
The canonical SMILES for acetic acid;ethyl 2-aminoacetate;hydrochloride is CC(=O)O.CCOC(=O)CN.Cl.
What is the InChIKey of acetic acid;ethyl 2-aminoacetate;hydrochloride?
The InChIKey is OQVBTOHPGYKRAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.C2H4O2.ClH/c1-2-7-4(6)3-5;1-2(3)4;/h2-3,5H2,1H3;1H3,(H,3,4);1H.
What are the key properties of acetic acid;ethyl 2-aminoacetate;hydrochloride?
acetic acid;ethyl 2-aminoacetate;hydrochloride has a molecular weight of 199.63 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;ethyl 2-aminoacetate;hydrochloride is sourced from PubChem (CID 172784195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).