C7H14O6 — CID 88571219
(2R,3R,4R,5R)-2,3,5-trihydroxy-4-methoxyhexanoic acid (PubChem CID 88571219) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,5-trihydroxy-4-methoxyhexanoic acid.
| Compound Name | (2R,3R,4R,5R)-2,3,5-trihydroxy-4-methoxyhexanoic acid |
|---|---|
| PubChem CID | 88571219 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,5-trihydroxy-4-methoxyhexanoic acid |
| SMILES | CO[C@@H]([C@H](O)[C@@H](O)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C7H14O6/c1-3(8)6(13-2)4(9)5(10)7(11)12/h3-6,8-10H,1-2H3,(H,11,12)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | YNCVKSYXMXTXOH-KVTDHHQDSA-N |
| XLogP | -1.81 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.18 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |