2,3-dihydroxy-4,5-dimethoxypentanoic acid

C7H14O6 — CID 22664319

IUPAC2,3-dihydroxy-4,5-dimethoxypentanoic acid
SMILESCOCC(OC)C(O)C(O)C(=O)O
InChIInChI=1S/C7H14O6/c1-12-3-4(13-2)5(8)6(9)7(10)11/h4-6,8-9H,3H2,1-2H3,(H,10,11)
InChIKeyFPZZQJWKBRDZIF-UHFFFAOYSA-N
MW194.18 g/mol
LogP-1.55
Rot. Bonds6

About 2,3-dihydroxy-4,5-dimethoxypentanoic acid

2,3-dihydroxy-4,5-dimethoxypentanoic acid (PubChem CID 22664319) has the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. Its IUPAC name is 2,3-dihydroxy-4,5-dimethoxypentanoic acid.

Molecular Properties

Compound Name2,3-dihydroxy-4,5-dimethoxypentanoic acid
PubChem CID22664319
Molecular FormulaC7H14O6
Molecular Weight194.18 g/mol
Exact Mass194.08
IUPAC Name2,3-dihydroxy-4,5-dimethoxypentanoic acid
SMILESCOCC(OC)C(O)C(O)C(=O)O
InChIInChI=1S/C7H14O6/c1-12-3-4(13-2)5(8)6(9)7(10)11/h4-6,8-9H,3H2,1-2H3,(H,10,11)
InChIKeyFPZZQJWKBRDZIF-UHFFFAOYSA-N
XLogP-1.55
TPSA96.22 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.18
LogP ≤ 5-1.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2,3-dihydroxy-4,5-dimethoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-4,5-dimethoxypentanoic acid?
The IUPAC name of 2,3-dihydroxy-4,5-dimethoxypentanoic acid (CID 22664319) is 2,3-dihydroxy-4,5-dimethoxypentanoic acid.
What is the SMILES notation for 2,3-dihydroxy-4,5-dimethoxypentanoic acid?
The canonical SMILES for 2,3-dihydroxy-4,5-dimethoxypentanoic acid is COCC(OC)C(O)C(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxy-4,5-dimethoxypentanoic acid?
The InChIKey is FPZZQJWKBRDZIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O6/c1-12-3-4(13-2)5(8)6(9)7(10)11/h4-6,8-9H,3H2,1-2H3,(H,10,11).
What are the key properties of 2,3-dihydroxy-4,5-dimethoxypentanoic acid?
2,3-dihydroxy-4,5-dimethoxypentanoic acid has a molecular weight of 194.18 g/mol, XLogP of -1.55, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-4,5-dimethoxypentanoic acid is sourced from PubChem (CID 22664319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).