C10H21NO6 — CID 54343689
(2R,3S,4R,5R)-4-hydroxy-2,3,5,6-tetramethoxyhexanamide (PubChem CID 54343689) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is (2R,3S,4R,5R)-4-hydroxy-2,3,5,6-tetramethoxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-4-hydroxy-2,3,5,6-tetramethoxyhexanamide |
|---|---|
| PubChem CID | 54343689 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (2R,3S,4R,5R)-4-hydroxy-2,3,5,6-tetramethoxyhexanamide |
| SMILES | COC[C@@H](OC)[C@@H](O)[C@H](OC)[C@@H](OC)C(N)=O |
| InChI | InChI=1S/C10H21NO6/c1-14-5-6(15-2)7(12)8(16-3)9(17-4)10(11)13/h6-9,12H,5H2,1-4H3,(H2,11,13)/t6-,7-,8+,9-/m1/s1 |
| InChIKey | UATQSTLQWBTGTC-LURQLKTLSA-N |
| XLogP | -1.48 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |