C5H10N2O4 — CID 131227841
(2R,3R)-2-hydroxy-3-methoxybutanediamide (PubChem CID 131227841) has the molecular formula C5H10N2O4 and a molecular weight of 162.15 g/mol. Its IUPAC name is (2R,3R)-2-hydroxy-3-methoxybutanediamide.
| Compound Name | (2R,3R)-2-hydroxy-3-methoxybutanediamide |
|---|---|
| PubChem CID | 131227841 |
| Molecular Formula | C5H10N2O4 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | (2R,3R)-2-hydroxy-3-methoxybutanediamide |
| SMILES | CO[C@@H](C(N)=O)[C@@H](O)C(N)=O |
| InChI | InChI=1S/C5H10N2O4/c1-11-3(5(7)10)2(8)4(6)9/h2-3,8H,1H3,(H2,6,9)(H2,7,10)/t2-,3-/m1/s1 |
| InChIKey | PYQRTORZNTUNDC-PWNYCUMCSA-N |
| XLogP | -2.67 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |