C5H12N2O3 — CID 143903860
2-amino-3,3-dimethoxypropanamide (PubChem CID 143903860) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-amino-3,3-dimethoxypropanamide.
| Compound Name | 2-amino-3,3-dimethoxypropanamide |
|---|---|
| PubChem CID | 143903860 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 2-amino-3,3-dimethoxypropanamide |
| SMILES | COC(OC)C(N)C(N)=O |
| InChI | InChI=1S/C5H12N2O3/c1-9-5(10-2)3(6)4(7)8/h3,5H,6H2,1-2H3,(H2,7,8) |
| InChIKey | WNAZTDVXKJCZJY-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|