C3H9N3OS — CID 88971531
(2S)-2,3-diamino-3-sulfanylpropanamide (PubChem CID 88971531) has the molecular formula C3H9N3OS and a molecular weight of 135.19 g/mol. Its IUPAC name is (2S)-2,3-diamino-3-sulfanylpropanamide.
| Compound Name | (2S)-2,3-diamino-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 88971531 |
| Molecular Formula | C3H9N3OS |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.05 |
| IUPAC Name | (2S)-2,3-diamino-3-sulfanylpropanamide |
| SMILES | NC(=O)[C@H](N)C(N)S |
| InChI | InChI=1S/C3H9N3OS/c4-1(2(5)7)3(6)8/h1,3,8H,4,6H2,(H2,5,7)/t1-,3?/m0/s1 |
| InChIKey | WEUJYQSXFPCDFG-QJRUMKIFSA-N |
| XLogP | -1.99 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|