C12H22O8 — CID 59866878
dimethyl (2S,3R,4S,5R)-2,3,4,5-tetramethoxyhexanedioate (PubChem CID 59866878) has the molecular formula C12H22O8 and a molecular weight of 294.30 g/mol. Its IUPAC name is dimethyl (2S,3R,4S,5R)-2,3,4,5-tetramethoxyhexanedioate.
| Compound Name | dimethyl (2S,3R,4S,5R)-2,3,4,5-tetramethoxyhexanedioate |
|---|---|
| PubChem CID | 59866878 |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | dimethyl (2S,3R,4S,5R)-2,3,4,5-tetramethoxyhexanedioate |
| SMILES | COC(=O)[C@@H](OC)[C@H](OC)[C@H](OC)[C@@H](OC)C(=O)OC |
| InChI | InChI=1S/C12H22O8/c1-15-7(9(17-3)11(13)19-5)8(16-2)10(18-4)12(14)20-6/h7-10H,1-6H3/t7-,8+,9+,10- |
| InChIKey | SKNSJNLGVRGJHQ-FIRGSJFUSA-N |
| XLogP | -0.61 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |