C13H20O4 — CID 101474895
dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)propanedioate (PubChem CID 101474895) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)propanedioate.
| Compound Name | dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)propanedioate |
|---|---|
| PubChem CID | 101474895 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | dimethyl 2-(5,5-dimethylhexa-2,3-dienyl)propanedioate |
| SMILES | COC(=O)C(CC=C=CC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C13H20O4/c1-13(2,3)9-7-6-8-10(11(14)16-4)12(15)17-5/h6,9-10H,8H2,1-5H3 |
| InChIKey | XRQAAKFKQXGWLO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|