C26H36O8 — CID 139257440
tetramethyl (2E)-15,15-dimethylhexadeca-2,12,13-trien-7-yne-4,4,9,9-tetracarboxylate (PubChem CID 139257440) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is tetramethyl (2E)-15,15-dimethylhexadeca-2,12,13-trien-7-yne-4,4,9,9-tetracarboxylate.
| Compound Name | tetramethyl (2E)-15,15-dimethylhexadeca-2,12,13-trien-7-yne-4,4,9,9-tetracarboxylate |
|---|---|
| PubChem CID | 139257440 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | tetramethyl (2E)-15,15-dimethylhexadeca-2,12,13-trien-7-yne-4,4,9,9-tetracarboxylate |
| SMILES | C/C=C/CC(CC#CCC(CC=C=CC(C)(C)C)(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C26H36O8/c1-9-10-16-25(20(27)31-5,21(28)32-6)18-13-14-19-26(22(29)33-7,23(30)34-8)17-12-11-15-24(2,3)4/h9-10,12,15H,16-19H2,1-8H3/b10-9+ |
| InChIKey | OWCPBSHOAGSSCN-MDZDMXLPSA-N |
| XLogP | 3.55 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|