C14H18O6 — CID 101012124
trimethyl (E)-oct-6-en-1-yne-1,4,4-tricarboxylate (PubChem CID 101012124) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is trimethyl (E)-oct-6-en-1-yne-1,4,4-tricarboxylate.
| Compound Name | trimethyl (E)-oct-6-en-1-yne-1,4,4-tricarboxylate |
|---|---|
| PubChem CID | 101012124 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | trimethyl (E)-oct-6-en-1-yne-1,4,4-tricarboxylate |
| SMILES | C/C=C/CC(CC#CC(=O)OC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H18O6/c1-5-6-9-14(12(16)19-3,13(17)20-4)10-7-8-11(15)18-2/h5-6H,9-10H2,1-4H3/b6-5+ |
| InChIKey | QLERVKHPUQBRMI-AATRIKPKSA-N |
| XLogP | 0.85 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|