C16H20O5 — CID 102009560
dimethyl 2-but-2-ynyl-2-[(E)-3-[(1S,2R)-2-formylcyclopropyl]prop-2-enyl]propanedioate (PubChem CID 102009560) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is dimethyl 2-but-2-ynyl-2-[(E)-3-[(1S,2R)-2-formylcyclopropyl]prop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-but-2-ynyl-2-[(E)-3-[(1S,2R)-2-formylcyclopropyl]prop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102009560 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | dimethyl 2-but-2-ynyl-2-[(E)-3-[(1S,2R)-2-formylcyclopropyl]prop-2-enyl]propanedioate |
| SMILES | CC#CCC(C/C=C/[C@@H]1C[C@H]1C=O)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C16H20O5/c1-4-5-8-16(14(18)20-2,15(19)21-3)9-6-7-12-10-13(12)11-17/h6-7,11-13H,8-10H2,1-3H3/b7-6+/t12-,13+/m1/s1 |
| InChIKey | OFLLELULFWYDDG-VWWYUBIBSA-N |
| XLogP | 1.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|