C19H30O4Si — CID 12046805
dimethyl 2-[(E)-5-methyl-4-methylidenehex-2-enyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate (PubChem CID 12046805) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is dimethyl 2-[(E)-5-methyl-4-methylidenehex-2-enyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate.
| Compound Name | dimethyl 2-[(E)-5-methyl-4-methylidenehex-2-enyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
|---|---|
| PubChem CID | 12046805 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | dimethyl 2-[(E)-5-methyl-4-methylidenehex-2-enyl]-2-(3-trimethylsilylprop-2-ynyl)propanedioate |
| SMILES | C=C(/C=C/CC(CC#C[Si](C)(C)C)(C(=O)OC)C(=O)OC)C(C)C |
| InChI | InChI=1S/C19H30O4Si/c1-15(2)16(3)11-9-12-19(17(20)22-4,18(21)23-5)13-10-14-24(6,7)8/h9,11,15H,3,12-13H2,1-2,4-8H3/b11-9+ |
| InChIKey | RPVRWPGIEXFZIS-PKNBQFBNSA-N |
| XLogP | 3.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|