C13H16O6 — CID 100942599
(E)-6,6-bis(methoxycarbonyl)non-3-en-8-ynoic acid (PubChem CID 100942599) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is (E)-6,6-bis(methoxycarbonyl)non-3-en-8-ynoic acid.
| Compound Name | (E)-6,6-bis(methoxycarbonyl)non-3-en-8-ynoic acid |
|---|---|
| PubChem CID | 100942599 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (E)-6,6-bis(methoxycarbonyl)non-3-en-8-ynoic acid |
| SMILES | C#CCC(C/C=C/CC(=O)O)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H16O6/c1-4-8-13(11(16)18-2,12(17)19-3)9-6-5-7-10(14)15/h1,5-6H,7-9H2,2-3H3,(H,14,15)/b6-5+ |
| InChIKey | OVEWUDJHHNKSOT-AATRIKPKSA-N |
| XLogP | 0.76 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|