C24H30O4 — CID 102244041
dimethyl 2-[(2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate (PubChem CID 102244041) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is dimethyl 2-[(2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate.
| Compound Name | dimethyl 2-[(2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 102244041 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | dimethyl 2-[(2E,6E)-3,7-dimethyl-8-phenylocta-2,6-dienyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C/C=C(\C)CC/C=C(\C)Cc1ccccc1)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H30O4/c1-6-16-24(22(25)27-4,23(26)28-5)17-15-19(2)11-10-12-20(3)18-21-13-8-7-9-14-21/h1,7-9,12-15H,10-11,16-18H2,2-5H3/b19-15+,20-12+ |
| InChIKey | MZZZHEDRJYPGJE-UYCURAHMSA-N |
| XLogP | 4.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|