C21H30O2 — CID 69178504
1-(furan-2-yl)-5,9,13-trimethyltetradeca-4,8,12-trien-1-one (PubChem CID 69178504) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-(furan-2-yl)-5,9,13-trimethyltetradeca-4,8,12-trien-1-one.
| Compound Name | 1-(furan-2-yl)-5,9,13-trimethyltetradeca-4,8,12-trien-1-one |
|---|---|
| PubChem CID | 69178504 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-(furan-2-yl)-5,9,13-trimethyltetradeca-4,8,12-trien-1-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(=O)c1ccco1 |
| InChI | InChI=1S/C21H30O2/c1-17(2)9-5-10-18(3)11-6-12-19(4)13-7-14-20(22)21-15-8-16-23-21/h8-9,11,13,15-16H,5-7,10,12,14H2,1-4H3 |
| InChIKey | VWJOEZCAPGHCSC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|