C15H20O2S — CID 11807557
S-(furan-2-ylmethyl) (2E)-3,7-dimethylocta-2,6-dienethioate (PubChem CID 11807557) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is S-(furan-2-ylmethyl) (2E)-3,7-dimethylocta-2,6-dienethioate.
| Compound Name | S-(furan-2-ylmethyl) (2E)-3,7-dimethylocta-2,6-dienethioate |
|---|---|
| PubChem CID | 11807557 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | S-(furan-2-ylmethyl) (2E)-3,7-dimethylocta-2,6-dienethioate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)SCc1ccco1 |
| InChI | InChI=1S/C15H20O2S/c1-12(2)6-4-7-13(3)10-15(16)18-11-14-8-5-9-17-14/h5-6,8-10H,4,7,11H2,1-3H3/b13-10+ |
| InChIKey | SQPCJQAPXYUACT-JLHYYAGUSA-N |
| XLogP | 4.73 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|