C16H19ClO2 — CID 170275246
(2-chlorophenyl) (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 170275246) has the molecular formula C16H19ClO2 and a molecular weight of 278.78 g/mol. Its IUPAC name is (2-chlorophenyl) (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | (2-chlorophenyl) (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 170275246 |
| Molecular Formula | C16H19ClO2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2-chlorophenyl) (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C16H19ClO2/c1-12(2)7-6-8-13(3)11-16(18)19-15-10-5-4-9-14(15)17/h4-5,7,9-11H,6,8H2,1-3H3/b13-11+ |
| InChIKey | SZJLNRUJAAUZRS-ACCUITESSA-N |
| XLogP | 4.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|