C20H28O2 — CID 170275266
(5-methyl-2-propan-2-ylphenyl) (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 170275266) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 170275266 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)Oc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C20H28O2/c1-14(2)8-7-9-16(5)13-20(21)22-19-12-17(6)10-11-18(19)15(3)4/h8,10-13,15H,7,9H2,1-6H3/b16-13+ |
| InChIKey | BDTUUNPFAWTKLV-DTQAZKPQSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|