C22H32O2 — CID 139600048
(5-methyl-2-propan-2-ylphenyl) 3-ethenyl-3,7-dimethyloct-6-enoate (PubChem CID 139600048) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 3-ethenyl-3,7-dimethyloct-6-enoate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 3-ethenyl-3,7-dimethyloct-6-enoate |
|---|---|
| PubChem CID | 139600048 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 3-ethenyl-3,7-dimethyloct-6-enoate |
| SMILES | C=CC(C)(CCC=C(C)C)CC(=O)Oc1cc(C)ccc1C(C)C |
| InChI | InChI=1S/C22H32O2/c1-8-22(7,13-9-10-16(2)3)15-21(23)24-20-14-18(6)11-12-19(20)17(4)5/h8,10-12,14,17H,1,9,13,15H2,2-7H3 |
| InChIKey | KNLDMHRUFLTMHY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|