C27H31Cl2NO5 — CID 139790238
[3-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-hydroxypropyl] (2E)-3,7-dimethylocta-2,6-dienoate (PubChem CID 139790238) has the molecular formula C27H31Cl2NO5 and a molecular weight of 520.45 g/mol. Its IUPAC name is [3-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-hydroxypropyl] (2E)-3,7-dimethylocta-2,6-dienoate.
| Compound Name | [3-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-hydroxypropyl] (2E)-3,7-dimethylocta-2,6-dienoate |
|---|---|
| PubChem CID | 139790238 |
| Molecular Formula | C27H31Cl2NO5 |
| Molecular Weight | 520.45 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | [3-[2-[2-(2,6-dichloroanilino)phenyl]acetyl]oxy-2-hydroxypropyl] (2E)-3,7-dimethylocta-2,6-dienoate |
| SMILES | CC(C)=CCC/C(C)=C/C(=O)OCC(O)COC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H31Cl2NO5/c1-18(2)8-6-9-19(3)14-25(32)34-16-21(31)17-35-26(33)15-20-10-4-5-13-24(20)30-27-22(28)11-7-12-23(27)29/h4-5,7-8,10-14,21,30-31H,6,9,15-17H2,1-3H3/b19-14+ |
| InChIKey | AWLXEMNTNZXDHA-XMHGGMMESA-N |
| XLogP | 6.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.45 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|