C24H27Cl2NO2 — CID 54552095
3,7-dimethylocta-2,6-dienyl 2-[2-(2,6-dichloroanilino)phenyl]acetate (PubChem CID 54552095) has the molecular formula C24H27Cl2NO2 and a molecular weight of 432.39 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienyl 2-[2-(2,6-dichloroanilino)phenyl]acetate.
| Compound Name | 3,7-dimethylocta-2,6-dienyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
|---|---|
| PubChem CID | 54552095 |
| Molecular Formula | C24H27Cl2NO2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienyl 2-[2-(2,6-dichloroanilino)phenyl]acetate |
| SMILES | CC(C)=CCCC(C)=CCOC(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H27Cl2NO2/c1-17(2)8-6-9-18(3)14-15-29-23(28)16-19-10-4-5-13-22(19)27-24-20(25)11-7-12-21(24)26/h4-5,7-8,10-14,27H,6,9,15-16H2,1-3H3 |
| InChIKey | ZKPIJPVMYCRGDY-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|